C19H14N4O4S — CID 3123698
N-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 3123698) has the molecular formula C19H14N4O4S and a molecular weight of 394.41 g/mol. Its IUPAC name is N-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 3123698 |
| Molecular Formula | C19H14N4O4S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | N-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(C=NNc2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C19H14N4O4S/c1-26-17-10-12(23(24)25)6-8-14(17)16-9-7-13(27-16)11-20-22-19-21-15-4-2-3-5-18(15)28-19/h2-11H,1H3,(H,21,22) |
| InChIKey | QZJWZRNVPPHSPH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|