C17H19N3O6 — CID 6883311
tert-butyl N-[(E)-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]carbamate (PubChem CID 6883311) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is tert-butyl N-[(E)-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 6883311 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | tert-butyl N-[(E)-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]carbamate |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(/C=N/NC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C17H19N3O6/c1-17(2,3)26-16(21)19-18-10-12-6-8-14(25-12)13-7-5-11(20(22)23)9-15(13)24-4/h5-10H,1-4H3,(H,19,21)/b18-10+ |
| InChIKey | DVVOUJGOZUTTGK-VCHYOVAHSA-N |
| XLogP | 3.72 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|