C19H15N3O7 — CID 50885197
2-hydroxy-5-[2-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]benzoic acid (PubChem CID 50885197) has the molecular formula C19H15N3O7 and a molecular weight of 397.34 g/mol. Its IUPAC name is 2-hydroxy-5-[2-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]benzoic acid.
| Compound Name | 2-hydroxy-5-[2-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 50885197 |
| Molecular Formula | C19H15N3O7 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-hydroxy-5-[2-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]benzoic acid |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(C=NNc2ccc(O)c(C(=O)O)c2)o1 |
| InChI | InChI=1S/C19H15N3O7/c1-28-18-9-12(22(26)27)3-5-14(18)17-7-4-13(29-17)10-20-21-11-2-6-16(23)15(8-11)19(24)25/h2-10,21,23H,1H3,(H,24,25) |
| InChIKey | PCMJZXIXMRALLK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|