C20H21N5O5 — CID 5457793
5-tert-butyl-N-[(Z)-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-1H-pyrazole-3-carboxamide (PubChem CID 5457793) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is 5-tert-butyl-N-[(Z)-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[(Z)-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5457793 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 5-tert-butyl-N-[(Z)-[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-1H-pyrazole-3-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(/C=N\NC(=O)c2cc(C(C)(C)C)[nH]n2)o1 |
| InChI | InChI=1S/C20H21N5O5/c1-20(2,3)18-10-15(22-23-18)19(26)24-21-11-13-6-8-16(30-13)14-7-5-12(25(27)28)9-17(14)29-4/h5-11H,1-4H3,(H,22,23)(H,24,26)/b21-11- |
| InChIKey | GJVDRGXRJKNERW-NHDPSOOVSA-N |
| XLogP | 3.65 |
| TPSA | 135.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|