C19H12N3O3S- — CID 7243069
3-[5-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]furan-2-yl]benzoate (PubChem CID 7243069) has the molecular formula C19H12N3O3S- and a molecular weight of 362.39 g/mol. Its IUPAC name is 3-[5-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 3-[5-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7243069 |
| Molecular Formula | C19H12N3O3S- |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 3-[5-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]furan-2-yl]benzoate |
| SMILES | O=C([O-])c1cccc(-c2ccc(/C=N\Nc3nc4ccccc4s3)o2)c1 |
| InChI | InChI=1S/C19H13N3O3S/c23-18(24)13-5-3-4-12(10-13)16-9-8-14(25-16)11-20-22-19-21-15-6-1-2-7-17(15)26-19/h1-11H,(H,21,22)(H,23,24)/p-1/b20-11- |
| InChIKey | OWUDGUNBNDBXHA-JAIQZWGSSA-M |
| XLogP | 3.37 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|