C15H13N6O3- — CID 7240982
3-[5-[(E)-[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]furan-2-yl]benzoate (PubChem CID 7240982) has the molecular formula C15H13N6O3- and a molecular weight of 325.31 g/mol. Its IUPAC name is 3-[5-[(E)-[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]furan-2-yl]benzoate.
| Compound Name | 3-[5-[(E)-[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7240982 |
| Molecular Formula | C15H13N6O3- |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 3-[5-[(E)-[(4-amino-5-methyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]furan-2-yl]benzoate |
| SMILES | Cc1nnc(N/N=C/c2ccc(-c3cccc(C(=O)[O-])c3)o2)n1N |
| InChI | InChI=1S/C15H14N6O3/c1-9-18-20-15(21(9)16)19-17-8-12-5-6-13(24-12)10-3-2-4-11(7-10)14(22)23/h2-8H,16H2,1H3,(H,19,20)(H,22,23)/p-1/b17-8+ |
| InChIKey | XLZDLXTZFGCLKX-CAOOACKPSA-M |
| XLogP | 0.37 |
| TPSA | 134.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|