C16H18ClN7O3 — CID 73449165
3-N-[[5-(2,5-dimethyl-4-nitrophenyl)furan-2-yl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 73449165) has the molecular formula C16H18ClN7O3 and a molecular weight of 391.82 g/mol. Its IUPAC name is 3-N-[[5-(2,5-dimethyl-4-nitrophenyl)furan-2-yl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[[5-(2,5-dimethyl-4-nitrophenyl)furan-2-yl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 73449165 |
| Molecular Formula | C16H18ClN7O3 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 3-N-[[5-(2,5-dimethyl-4-nitrophenyl)furan-2-yl]methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1-c1ccc(C=NNc2nnc(C)n2N)o1.Cl |
| InChI | InChI=1S/C16H17N7O3.ClH/c1-9-7-14(23(24)25)10(2)6-13(9)15-5-4-12(26-15)8-18-20-16-21-19-11(3)22(16)17;/h4-8H,17H2,1-3H3,(H,20,21);1H |
| InChIKey | XBGXYFWYVVISQN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|