C13H11N7O3 — CID 3541000
3-N-[[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 3541000) has the molecular formula C13H11N7O3 and a molecular weight of 313.28 g/mol. Its IUPAC name is 3-N-[[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 3541000 |
| Molecular Formula | C13H11N7O3 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-N-[[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | Nn1cnnc1NN=Cc1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C13H11N7O3/c14-19-8-16-18-13(19)17-15-7-9-5-6-12(23-9)10-3-1-2-4-11(10)20(21)22/h1-8H,14H2,(H,17,18) |
| InChIKey | RCKZQUMRCGOJOE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|