C9H9N7O2 — CID 6070487
3-N-[(Z)-(2-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 6070487) has the molecular formula C9H9N7O2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 3-N-[(Z)-(2-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(Z)-(2-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 6070487 |
| Molecular Formula | C9H9N7O2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 3-N-[(Z)-(2-nitrophenyl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | Nn1cnnc1N/N=C\c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N7O2/c10-15-6-12-14-9(15)13-11-5-7-3-1-2-4-8(7)16(17)18/h1-6H,10H2,(H,13,14)/b11-5- |
| InChIKey | LEYDGVHCTIECTP-WZUFQYTHSA-N |
| XLogP | 0.35 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|