C9H8BrN7O3 — CID 171980587
2-[(E)-[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-6-bromo-4-nitrophenol (PubChem CID 171980587) has the molecular formula C9H8BrN7O3 and a molecular weight of 342.11 g/mol. Its IUPAC name is 2-[(E)-[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-6-bromo-4-nitrophenol.
| Compound Name | 2-[(E)-[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-6-bromo-4-nitrophenol |
|---|---|
| PubChem CID | 171980587 |
| Molecular Formula | C9H8BrN7O3 |
| Molecular Weight | 342.11 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2-[(E)-[(4-amino-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-6-bromo-4-nitrophenol |
| SMILES | Nn1cnnc1N/N=C/c1cc([N+](=O)[O-])cc(Br)c1O |
| InChI | InChI=1S/C9H8BrN7O3/c10-7-2-6(17(19)20)1-5(8(7)18)3-12-14-9-15-13-4-16(9)11/h1-4,18H,11H2,(H,14,15)/b12-3+ |
| InChIKey | FUHGEIFHQRADEW-KGVSQERTSA-N |
| XLogP | 0.81 |
| TPSA | 144.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.11 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|