C10H11Cl2N7O4 — CID 171700457
3-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride (PubChem CID 171700457) has the molecular formula C10H11Cl2N7O4 and a molecular weight of 364.15 g/mol. Its IUPAC name is 3-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride.
| Compound Name | 3-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 171700457 |
| Molecular Formula | C10H11Cl2N7O4 |
| Molecular Weight | 364.15 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 3-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nn1cnnc1N/N=C/c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C10H9N7O4.2ClH/c11-16-4-13-15-10(16)14-12-3-6-1-8-9(21-5-20-8)2-7(6)17(18)19;;/h1-4H,5,11H2,(H,14,15);2*1H/b12-3+;; |
| InChIKey | KHTNHRPQJIPKQM-VELGEHSVSA-N |
| XLogP | 0.92 |
| TPSA | 142.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.15 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|