C10H9BrN6O2 — CID 3818315
3-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine (PubChem CID 3818315) has the molecular formula C10H9BrN6O2 and a molecular weight of 325.13 g/mol. Its IUPAC name is 3-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 3818315 |
| Molecular Formula | C10H9BrN6O2 |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 3-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,2,4-triazole-3,4-diamine |
| SMILES | Nn1cnnc1NN=Cc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C10H9BrN6O2/c11-7-2-9-8(18-5-19-9)1-6(7)3-13-15-10-16-14-4-17(10)12/h1-4H,5,12H2,(H,15,16) |
| InChIKey | WYWLSJULPVHFII-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|