C11H11BrN6O2 — CID 3706449
3-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine (PubChem CID 3706449) has the molecular formula C11H11BrN6O2 and a molecular weight of 339.15 g/mol. Its IUPAC name is 3-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 3706449 |
| Molecular Formula | C11H11BrN6O2 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 3-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine |
| SMILES | Cc1nnc(NN=Cc2cc3c(cc2Br)OCO3)n1N |
| InChI | InChI=1S/C11H11BrN6O2/c1-6-15-17-11(18(6)13)16-14-4-7-2-9-10(3-8(7)12)20-5-19-9/h2-4H,5,13H2,1H3,(H,16,17) |
| InChIKey | XLZVUEGFCCHHIQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|