C10H11BrN6 — CID 45042743
3-N-[(E)-(3-bromophenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine (PubChem CID 45042743) has the molecular formula C10H11BrN6 and a molecular weight of 295.14 g/mol. Its IUPAC name is 3-N-[(E)-(3-bromophenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(E)-(3-bromophenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 45042743 |
| Molecular Formula | C10H11BrN6 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 3-N-[(E)-(3-bromophenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine |
| SMILES | Cc1nnc(N/N=C/c2cccc(Br)c2)n1N |
| InChI | InChI=1S/C10H11BrN6/c1-7-14-16-10(17(7)12)15-13-6-8-3-2-4-9(11)5-8/h2-6H,12H2,1H3,(H,15,16)/b13-6+ |
| InChIKey | KXBDTSDESOSDOL-AWNIVKPZSA-N |
| XLogP | 1.51 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|