C11H13BrN6O — CID 577046
3-N-[(3-bromo-4-methoxyphenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine (PubChem CID 577046) has the molecular formula C11H13BrN6O and a molecular weight of 325.17 g/mol. Its IUPAC name is 3-N-[(3-bromo-4-methoxyphenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine.
| Compound Name | 3-N-[(3-bromo-4-methoxyphenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 577046 |
| Molecular Formula | C11H13BrN6O |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 3-N-[(3-bromo-4-methoxyphenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine |
| SMILES | COc1ccc(C=NNc2nnc(C)n2N)cc1Br |
| InChI | InChI=1S/C11H13BrN6O/c1-7-15-17-11(18(7)13)16-14-6-8-3-4-10(19-2)9(12)5-8/h3-6H,13H2,1-2H3,(H,16,17) |
| InChIKey | NPWFRGYTBJKWNR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|