C11H14BrClN6O — CID 18529432
3-N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride (PubChem CID 18529432) has the molecular formula C11H14BrClN6O and a molecular weight of 361.63 g/mol. Its IUPAC name is 3-N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride.
| Compound Name | 3-N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 18529432 |
| Molecular Formula | C11H14BrClN6O |
| Molecular Weight | 361.63 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 3-N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-5-methyl-1,2,4-triazole-3,4-diamine;hydrochloride |
| SMILES | COc1ccc(Br)cc1/C=N/Nc1nnc(C)n1N.Cl |
| InChI | InChI=1S/C11H13BrN6O.ClH/c1-7-15-17-11(18(7)13)16-14-6-8-5-9(12)3-4-10(8)19-2;/h3-6H,13H2,1-2H3,(H,16,17);1H/b14-6+; |
| InChIKey | RCTIHIFNMURBHR-JSSTZBRYSA-N |
| XLogP | 1.94 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.63 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|