C16H17BrN2O — CID 110504942
N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-3,4-dimethylaniline (PubChem CID 110504942) has the molecular formula C16H17BrN2O and a molecular weight of 333.23 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-3,4-dimethylaniline.
| Compound Name | N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 110504942 |
| Molecular Formula | C16H17BrN2O |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-[(E)-(5-bromo-2-methoxyphenyl)methylideneamino]-3,4-dimethylaniline |
| SMILES | COc1ccc(Br)cc1/C=N/Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H17BrN2O/c1-11-4-6-15(8-12(11)2)19-18-10-13-9-14(17)5-7-16(13)20-3/h4-10,19H,1-3H3/b18-10+ |
| InChIKey | RNRNRUGDAAGTKU-VCHYOVAHSA-N |
| XLogP | 4.52 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|