C15H14BrN3OS — CID 5150962
1-[(5-bromo-2-methoxyphenyl)methylideneamino]-3-phenylthiourea (PubChem CID 5150962) has the molecular formula C15H14BrN3OS and a molecular weight of 364.27 g/mol. Its IUPAC name is 1-[(5-bromo-2-methoxyphenyl)methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(5-bromo-2-methoxyphenyl)methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 5150962 |
| Molecular Formula | C15H14BrN3OS |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 1-[(5-bromo-2-methoxyphenyl)methylideneamino]-3-phenylthiourea |
| SMILES | COc1ccc(Br)cc1C=NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C15H14BrN3OS/c1-20-14-8-7-12(16)9-11(14)10-17-19-15(21)18-13-5-3-2-4-6-13/h2-10H,1H3,(H2,18,19,21) |
| InChIKey | TXOQLLOOXSHJEY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|