C22H19Br2N3O3S — CID 162667887
1-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]-3-(4-phenoxyphenyl)thiourea (PubChem CID 162667887) has the molecular formula C22H19Br2N3O3S and a molecular weight of 565.29 g/mol. Its IUPAC name is 1-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]-3-(4-phenoxyphenyl)thiourea.
| Compound Name | 1-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]-3-(4-phenoxyphenyl)thiourea |
|---|---|
| PubChem CID | 162667887 |
| Molecular Formula | C22H19Br2N3O3S |
| Molecular Weight | 565.29 g/mol |
| Exact Mass | 562.95 |
| IUPAC Name | 1-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]-3-(4-phenoxyphenyl)thiourea |
| SMILES | COc1cc(/C=N/NC(=S)Nc2ccc(Oc3ccccc3)cc2)c(Br)c(Br)c1OC |
| InChI | InChI=1S/C22H19Br2N3O3S/c1-28-18-12-14(19(23)20(24)21(18)29-2)13-25-27-22(31)26-15-8-10-17(11-9-15)30-16-6-4-3-5-7-16/h3-13H,1-2H3,(H2,26,27,31)/b25-13+ |
| InChIKey | ZMHDWLNNISDMGL-DHRITJCHSA-N |
| XLogP | 6.34 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.29 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|