C16H14Br2ClN3O2S — CID 162673297
1-(4-chlorophenyl)-3-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]thiourea (PubChem CID 162673297) has the molecular formula C16H14Br2ClN3O2S and a molecular weight of 507.64 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 162673297 |
| Molecular Formula | C16H14Br2ClN3O2S |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 504.89 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(E)-(2,3-dibromo-4,5-dimethoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1cc(/C=N/NC(=S)Nc2ccc(Cl)cc2)c(Br)c(Br)c1OC |
| InChI | InChI=1S/C16H14Br2ClN3O2S/c1-23-12-7-9(13(17)14(18)15(12)24-2)8-20-22-16(25)21-11-5-3-10(19)4-6-11/h3-8H,1-2H3,(H2,21,22,25)/b20-8+ |
| InChIKey | CUBCOQHWHBMLGR-DNTJNYDQSA-N |
| XLogP | 5.20 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|