C19H23N3O5S — CID 6079549
1-(3,4-dimethoxyphenyl)-3-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]thiourea (PubChem CID 6079549) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6079549 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1ccc(NC(=S)N/N=C\c2ccc(OC)c(OC)c2OC)cc1OC |
| InChI | InChI=1S/C19H23N3O5S/c1-23-14-9-7-13(10-16(14)25-3)21-19(28)22-20-11-12-6-8-15(24-2)18(27-5)17(12)26-4/h6-11H,1-5H3,(H2,21,22,28)/b20-11- |
| InChIKey | LWVOYNWLTMWHDJ-JAIQZWGSSA-N |
| XLogP | 3.05 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|