C18H18Br2N2O2S — CID 2344852
2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-[(5-bromo-2-methoxyphenyl)methylideneamino]acetamide (PubChem CID 2344852) has the molecular formula C18H18Br2N2O2S and a molecular weight of 486.23 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-[(5-bromo-2-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-[(5-bromo-2-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 2344852 |
| Molecular Formula | C18H18Br2N2O2S |
| Molecular Weight | 486.23 g/mol |
| Exact Mass | 483.95 |
| IUPAC Name | 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-[(5-bromo-2-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(Br)cc1C=NNC(=O)CSc1cc(C)c(Br)cc1C |
| InChI | InChI=1S/C18H18Br2N2O2S/c1-11-7-17(12(2)6-15(11)20)25-10-18(23)22-21-9-13-8-14(19)4-5-16(13)24-3/h4-9H,10H2,1-3H3,(H,22,23) |
| InChIKey | IRGCGVUACWKHRT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.23 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|