C19H22BrN3OS — CID 6900774
2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]acetamide (PubChem CID 6900774) has the molecular formula C19H22BrN3OS and a molecular weight of 420.38 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6900774 |
| Molecular Formula | C19H22BrN3OS |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 2-(4-bromo-2,5-dimethylphenyl)sulfanyl-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]acetamide |
| SMILES | Cc1cc(SCC(=O)N/N=C/c2ccc(N(C)C)cc2)c(C)cc1Br |
| InChI | InChI=1S/C19H22BrN3OS/c1-13-10-18(14(2)9-17(13)20)25-12-19(24)22-21-11-15-5-7-16(8-6-15)23(3)4/h5-11H,12H2,1-4H3,(H,22,24)/b21-11+ |
| InChIKey | MMYMIEYEELCVEU-SRZZPIQSSA-N |
| XLogP | 4.37 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|