C20H26N6OS — CID 5087294
N-[[4-(dimethylamino)phenyl]methylideneamino]-2-(6-methyl-2-pyrrolidin-1-ylpyrimidin-4-yl)sulfanylacetamide (PubChem CID 5087294) has the molecular formula C20H26N6OS and a molecular weight of 398.54 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methylideneamino]-2-(6-methyl-2-pyrrolidin-1-ylpyrimidin-4-yl)sulfanylacetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-2-(6-methyl-2-pyrrolidin-1-ylpyrimidin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 5087294 |
| Molecular Formula | C20H26N6OS |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methylideneamino]-2-(6-methyl-2-pyrrolidin-1-ylpyrimidin-4-yl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)NN=Cc2ccc(N(C)C)cc2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C20H26N6OS/c1-15-12-19(23-20(22-15)26-10-4-5-11-26)28-14-18(27)24-21-13-16-6-8-17(9-7-16)25(2)3/h6-9,12-13H,4-5,10-11,14H2,1-3H3,(H,24,27) |
| InChIKey | WNKZOXVSYLVOLY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|