C20H23N5O2S — CID 6326506
N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-2-(5-methoxy-1-methylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 6326506) has the molecular formula C20H23N5O2S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-2-(5-methoxy-1-methylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-2-(5-methoxy-1-methylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 6326506 |
| Molecular Formula | C20H23N5O2S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-2-(5-methoxy-1-methylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | COc1ccc2c(c1)nc(SCC(=O)N/N=C\c1ccc(N(C)C)cc1)n2C |
| InChI | InChI=1S/C20H23N5O2S/c1-24(2)15-7-5-14(6-8-15)12-21-23-19(26)13-28-20-22-17-11-16(27-4)9-10-18(17)25(20)3/h5-12H,13H2,1-4H3,(H,23,26)/b21-12- |
| InChIKey | NOIGIYBPWDZRGD-MTJSOVHGSA-N |
| XLogP | 2.89 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|