C19H18N4O3S — CID 1185074
methyl 4-[[[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]hydrazinylidene]methyl]benzoate (PubChem CID 1185074) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is methyl 4-[[[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[[[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 1185074 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | methyl 4-[[[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=NNC(=O)CSc2nc3ccccc3n2C)cc1 |
| InChI | InChI=1S/C19H18N4O3S/c1-23-16-6-4-3-5-15(16)21-19(23)27-12-17(24)22-20-11-13-7-9-14(10-8-13)18(25)26-2/h3-11H,12H2,1-2H3,(H,22,24) |
| InChIKey | WKWILJCKIDOVPR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|