C18H21N5O3S — CID 135606852
N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)sulfanylacetamide (PubChem CID 135606852) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)sulfanylacetamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 135606852 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-2-(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)N/N=C/c2ccccc2O)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H21N5O3S/c1-13-10-17(21-18(20-13)23-6-8-26-9-7-23)27-12-16(25)22-19-11-14-4-2-3-5-15(14)24/h2-5,10-11,24H,6-9,12H2,1H3,(H,22,25)/b19-11+ |
| InChIKey | XMOGODITKCJWBW-YBFXNURJSA-N |
| XLogP | 1.57 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|