C19H25N5O3 — CID 136714352
2-[(Z)-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)hydrazinylidene]methyl]-5-propoxyphenol (PubChem CID 136714352) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-[(Z)-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)hydrazinylidene]methyl]-5-propoxyphenol.
| Compound Name | 2-[(Z)-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)hydrazinylidene]methyl]-5-propoxyphenol |
|---|---|
| PubChem CID | 136714352 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-[(Z)-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)hydrazinylidene]methyl]-5-propoxyphenol |
| SMILES | CCCOc1ccc(/C=N\Nc2cc(C)nc(N3CCOCC3)n2)c(O)c1 |
| InChI | InChI=1S/C19H25N5O3/c1-3-8-27-16-5-4-15(17(25)12-16)13-20-23-18-11-14(2)21-19(22-18)24-6-9-26-10-7-24/h4-5,11-13,25H,3,6-10H2,1-2H3,(H,21,22,23)/b20-13- |
| InChIKey | WEZIDBXQDOGEPM-MOSHPQCFSA-N |
| XLogP | 2.56 |
| TPSA | 92.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|