C15H18N4O3 — CID 3099332
2-[[(6-methoxypyrimidin-4-yl)hydrazinylidene]methyl]-5-propoxyphenol (PubChem CID 3099332) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-[[(6-methoxypyrimidin-4-yl)hydrazinylidene]methyl]-5-propoxyphenol.
| Compound Name | 2-[[(6-methoxypyrimidin-4-yl)hydrazinylidene]methyl]-5-propoxyphenol |
|---|---|
| PubChem CID | 3099332 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-[[(6-methoxypyrimidin-4-yl)hydrazinylidene]methyl]-5-propoxyphenol |
| SMILES | CCCOc1ccc(C=NNc2cc(OC)ncn2)c(O)c1 |
| InChI | InChI=1S/C15H18N4O3/c1-3-6-22-12-5-4-11(13(20)7-12)9-18-19-14-8-15(21-2)17-10-16-14/h4-5,7-10,20H,3,6H2,1-2H3,(H,16,17,19) |
| InChIKey | IYQKGIDIGABMOL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|