C17H16ClF3N2O2 — CID 4662927
2-[[[2-chloro-5-(trifluoromethyl)phenyl]hydrazinylidene]methyl]-5-propoxyphenol (PubChem CID 4662927) has the molecular formula C17H16ClF3N2O2 and a molecular weight of 372.77 g/mol. Its IUPAC name is 2-[[[2-chloro-5-(trifluoromethyl)phenyl]hydrazinylidene]methyl]-5-propoxyphenol.
| Compound Name | 2-[[[2-chloro-5-(trifluoromethyl)phenyl]hydrazinylidene]methyl]-5-propoxyphenol |
|---|---|
| PubChem CID | 4662927 |
| Molecular Formula | C17H16ClF3N2O2 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[[[2-chloro-5-(trifluoromethyl)phenyl]hydrazinylidene]methyl]-5-propoxyphenol |
| SMILES | CCCOc1ccc(C=NNc2cc(C(F)(F)F)ccc2Cl)c(O)c1 |
| InChI | InChI=1S/C17H16ClF3N2O2/c1-2-7-25-13-5-3-11(16(24)9-13)10-22-23-15-8-12(17(19,20)21)4-6-14(15)18/h3-6,8-10,23-24H,2,7H2,1H3 |
| InChIKey | YHTVRAUQNPJRMI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|