C17H15Cl2F3N2O — CID 110841966
N-[(3,5-dichloro-4-propoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline (PubChem CID 110841966) has the molecular formula C17H15Cl2F3N2O and a molecular weight of 391.22 g/mol. Its IUPAC name is N-[(3,5-dichloro-4-propoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline.
| Compound Name | N-[(3,5-dichloro-4-propoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 110841966 |
| Molecular Formula | C17H15Cl2F3N2O |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | N-[(3,5-dichloro-4-propoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline |
| SMILES | CCCOc1c(Cl)cc(C=NNc2ccc(C(F)(F)F)cc2)cc1Cl |
| InChI | InChI=1S/C17H15Cl2F3N2O/c1-2-7-25-16-14(18)8-11(9-15(16)19)10-23-24-13-5-3-12(4-6-13)17(20,21)22/h3-6,8-10,24H,2,7H2,1H3 |
| InChIKey | TUKMDCDUWSPITG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|