C21H16ClF3N2O — CID 110841957
N-[(3-chloro-4-phenylmethoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline (PubChem CID 110841957) has the molecular formula C21H16ClF3N2O and a molecular weight of 404.82 g/mol. Its IUPAC name is N-[(3-chloro-4-phenylmethoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline.
| Compound Name | N-[(3-chloro-4-phenylmethoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 110841957 |
| Molecular Formula | C21H16ClF3N2O |
| Molecular Weight | 404.82 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | N-[(3-chloro-4-phenylmethoxyphenyl)methylideneamino]-4-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccc(NN=Cc2ccc(OCc3ccccc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H16ClF3N2O/c22-19-12-16(6-11-20(19)28-14-15-4-2-1-3-5-15)13-26-27-18-9-7-17(8-10-18)21(23,24)25/h1-13,27H,14H2 |
| InChIKey | HMNUKVDOWGPOQZ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.82 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|