C21H19ClN2O — CID 110505513
N-[(E)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]-4-methylaniline (PubChem CID 110505513) has the molecular formula C21H19ClN2O and a molecular weight of 350.85 g/mol. Its IUPAC name is N-[(E)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]-4-methylaniline.
| Compound Name | N-[(E)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]-4-methylaniline |
|---|---|
| PubChem CID | 110505513 |
| Molecular Formula | C21H19ClN2O |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-[(E)-(3-chloro-4-phenylmethoxyphenyl)methylideneamino]-4-methylaniline |
| SMILES | Cc1ccc(N/N=C/c2ccc(OCc3ccccc3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H19ClN2O/c1-16-7-10-19(11-8-16)24-23-14-18-9-12-21(20(22)13-18)25-15-17-5-3-2-4-6-17/h2-14,24H,15H2,1H3/b23-14+ |
| InChIKey | TXTCFOUQOSPYCR-OEAKJJBVSA-N |
| XLogP | 5.67 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|