C22H19F3N2O2 — CID 169384243
N-[[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methylideneamino]aniline (PubChem CID 169384243) has the molecular formula C22H19F3N2O2 and a molecular weight of 400.40 g/mol. Its IUPAC name is N-[[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methylideneamino]aniline.
| Compound Name | N-[[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 169384243 |
| Molecular Formula | C22H19F3N2O2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-[[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]methylideneamino]aniline |
| SMILES | COc1cc(C=NNc2ccccc2)ccc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F3N2O2/c1-28-21-13-16(14-26-27-19-8-3-2-4-9-19)10-11-20(21)29-15-17-6-5-7-18(12-17)22(23,24)25/h2-14,27H,15H2,1H3 |
| InChIKey | BARHNJXDPOVECT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|