C21H25F3N2O2 — CID 110841736
N-[(4-hexoxy-3-methoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline (PubChem CID 110841736) has the molecular formula C21H25F3N2O2 and a molecular weight of 394.44 g/mol. Its IUPAC name is N-[(4-hexoxy-3-methoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline.
| Compound Name | N-[(4-hexoxy-3-methoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 110841736 |
| Molecular Formula | C21H25F3N2O2 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[(4-hexoxy-3-methoxyphenyl)methylideneamino]-3-(trifluoromethyl)aniline |
| SMILES | CCCCCCOc1ccc(C=NNc2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C21H25F3N2O2/c1-3-4-5-6-12-28-19-11-10-16(13-20(19)27-2)15-25-26-18-9-7-8-17(14-18)21(22,23)24/h7-11,13-15,26H,3-6,12H2,1-2H3 |
| InChIKey | PYRWQXXWFNOPGA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|