C23H28F3N3O3 — CID 110841772
2-[2-methoxy-4-[[[3-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]-N,N-dipropylacetamide (PubChem CID 110841772) has the molecular formula C23H28F3N3O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is 2-[2-methoxy-4-[[[3-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]-N,N-dipropylacetamide.
| Compound Name | 2-[2-methoxy-4-[[[3-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 110841772 |
| Molecular Formula | C23H28F3N3O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 2-[2-methoxy-4-[[[3-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)COc1ccc(C=NNc2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C23H28F3N3O3/c1-4-11-29(12-5-2)22(30)16-32-20-10-9-17(13-21(20)31-3)15-27-28-19-8-6-7-18(14-19)23(24,25)26/h6-10,13-15,28H,4-5,11-12,16H2,1-3H3 |
| InChIKey | IYSPWLUXAPKALJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|