C21H22F3N3O4 — CID 5228336
N'-[(3-methoxy-4-propoxyphenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 5228336) has the molecular formula C21H22F3N3O4 and a molecular weight of 437.42 g/mol. Its IUPAC name is N'-[(3-methoxy-4-propoxyphenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N'-[(3-methoxy-4-propoxyphenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 5228336 |
| Molecular Formula | C21H22F3N3O4 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N'-[(3-methoxy-4-propoxyphenyl)methylideneamino]-N-[3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | CCCOc1ccc(C=NNC(=O)CC(=O)Nc2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C21H22F3N3O4/c1-3-9-31-17-8-7-14(10-18(17)30-2)13-25-27-20(29)12-19(28)26-16-6-4-5-15(11-16)21(22,23)24/h4-8,10-11,13H,3,9,12H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | HPOATHYUIWVGBX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|