C30H29F3N4O7 — CID 4688879
ethyl 4-[[2-[2-methoxy-4-[[[4-oxo-4-[3-(trifluoromethyl)anilino]butanoyl]hydrazinylidene]methyl]phenoxy]acetyl]amino]benzoate (PubChem CID 4688879) has the molecular formula C30H29F3N4O7 and a molecular weight of 614.58 g/mol. Its IUPAC name is ethyl 4-[[2-[2-methoxy-4-[[[4-oxo-4-[3-(trifluoromethyl)anilino]butanoyl]hydrazinylidene]methyl]phenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[2-methoxy-4-[[[4-oxo-4-[3-(trifluoromethyl)anilino]butanoyl]hydrazinylidene]methyl]phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4688879 |
| Molecular Formula | C30H29F3N4O7 |
| Molecular Weight | 614.58 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | ethyl 4-[[2-[2-methoxy-4-[[[4-oxo-4-[3-(trifluoromethyl)anilino]butanoyl]hydrazinylidene]methyl]phenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc(C=NNC(=O)CCC(=O)Nc3cccc(C(F)(F)F)c3)cc2OC)cc1 |
| InChI | InChI=1S/C30H29F3N4O7/c1-3-43-29(41)20-8-10-22(11-9-20)35-28(40)18-44-24-12-7-19(15-25(24)42-2)17-34-37-27(39)14-13-26(38)36-23-6-4-5-21(16-23)30(31,32)33/h4-12,15-17H,3,13-14,18H2,1-2H3,(H,35,40)(H,36,38)(H,37,39) |
| InChIKey | JZSGCHXUEVUKBM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|