C19H19F3N2O4 — CID 19656010
ethyl 2-[2-methoxy-4-[(E)-[[3-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 19656010) has the molecular formula C19H19F3N2O4 and a molecular weight of 396.37 g/mol. Its IUPAC name is ethyl 2-[2-methoxy-4-[(E)-[[3-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-methoxy-4-[(E)-[[3-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 19656010 |
| Molecular Formula | C19H19F3N2O4 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | ethyl 2-[2-methoxy-4-[(E)-[[3-(trifluoromethyl)phenyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=N/Nc2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C19H19F3N2O4/c1-3-27-18(25)12-28-16-8-7-13(9-17(16)26-2)11-23-24-15-6-4-5-14(10-15)19(20,21)22/h4-11,24H,3,12H2,1-2H3/b23-11+ |
| InChIKey | ZUSCAWAXTIEFON-FOKLQQMPSA-N |
| XLogP | 4.10 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|