C23H29BrN2O3 — CID 110841392
3-[2-[(3-bromo-4-nonoxyphenyl)methylidene]hydrazinyl]benzoic acid (PubChem CID 110841392) has the molecular formula C23H29BrN2O3 and a molecular weight of 461.40 g/mol. Its IUPAC name is 3-[2-[(3-bromo-4-nonoxyphenyl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 3-[2-[(3-bromo-4-nonoxyphenyl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 110841392 |
| Molecular Formula | C23H29BrN2O3 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 3-[2-[(3-bromo-4-nonoxyphenyl)methylidene]hydrazinyl]benzoic acid |
| SMILES | CCCCCCCCCOc1ccc(C=NNc2cccc(C(=O)O)c2)cc1Br |
| InChI | InChI=1S/C23H29BrN2O3/c1-2-3-4-5-6-7-8-14-29-22-13-12-18(15-21(22)24)17-25-26-20-11-9-10-19(16-20)23(27)28/h9-13,15-17,26H,2-8,14H2,1H3,(H,27,28) |
| InChIKey | GPSPPUUVIVHUMF-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|