C15H13F3N2O2 — CID 169383696
2-[(phenylhydrazinylidene)methyl]-5-(2,2,2-trifluoroethoxy)phenol (PubChem CID 169383696) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.27 g/mol. Its IUPAC name is 2-[(phenylhydrazinylidene)methyl]-5-(2,2,2-trifluoroethoxy)phenol.
| Compound Name | 2-[(phenylhydrazinylidene)methyl]-5-(2,2,2-trifluoroethoxy)phenol |
|---|---|
| PubChem CID | 169383696 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-[(phenylhydrazinylidene)methyl]-5-(2,2,2-trifluoroethoxy)phenol |
| SMILES | Oc1cc(OCC(F)(F)F)ccc1C=NNc1ccccc1 |
| InChI | InChI=1S/C15H13F3N2O2/c16-15(17,18)10-22-13-7-6-11(14(21)8-13)9-19-20-12-4-2-1-3-5-12/h1-9,20-21H,10H2 |
| InChIKey | VEZQZONTCZXLCS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|