C16H14F3NO3 — CID 23035301
(NE)-N-[[2-phenylmethoxy-5-(2,2,2-trifluoroethoxy)phenyl]methylidene]hydroxylamine (PubChem CID 23035301) has the molecular formula C16H14F3NO3 and a molecular weight of 325.29 g/mol. Its IUPAC name is (NE)-N-[[2-phenylmethoxy-5-(2,2,2-trifluoroethoxy)phenyl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[2-phenylmethoxy-5-(2,2,2-trifluoroethoxy)phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 23035301 |
| Molecular Formula | C16H14F3NO3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (NE)-N-[[2-phenylmethoxy-5-(2,2,2-trifluoroethoxy)phenyl]methylidene]hydroxylamine |
| SMILES | O/N=C/c1cc(OCC(F)(F)F)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C16H14F3NO3/c17-16(18,19)11-23-14-6-7-15(13(8-14)9-20-21)22-10-12-4-2-1-3-5-12/h1-9,21H,10-11H2/b20-9+ |
| InChIKey | SXIDKOVADUCMAY-AWQFTUOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|