C18H14F6O4 — CID 23390398
benzyl 2,5-bis(2,2,2-trifluoroethoxy)benzoate (PubChem CID 23390398) has the molecular formula C18H14F6O4 and a molecular weight of 408.29 g/mol. Its IUPAC name is benzyl 2,5-bis(2,2,2-trifluoroethoxy)benzoate.
| Compound Name | benzyl 2,5-bis(2,2,2-trifluoroethoxy)benzoate |
|---|---|
| PubChem CID | 23390398 |
| Molecular Formula | C18H14F6O4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | benzyl 2,5-bis(2,2,2-trifluoroethoxy)benzoate |
| SMILES | O=C(OCc1ccccc1)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C18H14F6O4/c19-17(20,21)10-27-13-6-7-15(28-11-18(22,23)24)14(8-13)16(25)26-9-12-4-2-1-3-5-12/h1-8H,9-11H2 |
| InChIKey | DTQZFTWETPXFGH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |