C15H19F6NO3 — CID 158681446
methane;N-propan-2-yl-2,5-bis(2,2,2-trifluoroethoxy)benzamide (PubChem CID 158681446) has the molecular formula C15H19F6NO3 and a molecular weight of 375.31 g/mol. Its IUPAC name is methane;N-propan-2-yl-2,5-bis(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | methane;N-propan-2-yl-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 158681446 |
| Molecular Formula | C15H19F6NO3 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | methane;N-propan-2-yl-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
| SMILES | C.CC(C)NC(=O)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C14H15F6NO3.CH4/c1-8(2)21-12(22)10-5-9(23-6-13(15,16)17)3-4-11(10)24-7-14(18,19)20;/h3-5,8H,6-7H2,1-2H3,(H,21,22);1H4 |
| InChIKey | IFEJBRJOJVUFAZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |