C20H18F6N2O4 — CID 3657845
N-(2-benzamidoethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide (PubChem CID 3657845) has the molecular formula C20H18F6N2O4 and a molecular weight of 464.36 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(2-benzamidoethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 3657845 |
| Molecular Formula | C20H18F6N2O4 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | N-(2-benzamidoethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NCCNC(=O)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C20H18F6N2O4/c21-19(22,23)11-31-14-6-7-16(32-12-20(24,25)26)15(10-14)18(30)28-9-8-27-17(29)13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2,(H,27,29)(H,28,30) |
| InChIKey | KBBKKIIBXASIFQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|