C24H29F3N2O4 — CID 15055945
2-(3-phenoxypropoxy)-N-(piperidin-2-ylmethyl)-5-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 15055945) has the molecular formula C24H29F3N2O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is 2-(3-phenoxypropoxy)-N-(piperidin-2-ylmethyl)-5-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 2-(3-phenoxypropoxy)-N-(piperidin-2-ylmethyl)-5-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 15055945 |
| Molecular Formula | C24H29F3N2O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-(3-phenoxypropoxy)-N-(piperidin-2-ylmethyl)-5-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NCC1CCCCN1)c1cc(OCC(F)(F)F)ccc1OCCCOc1ccccc1 |
| InChI | InChI=1S/C24H29F3N2O4/c25-24(26,27)17-33-20-10-11-22(32-14-6-13-31-19-8-2-1-3-9-19)21(15-20)23(30)29-16-18-7-4-5-12-28-18/h1-3,8-11,15,18,28H,4-7,12-14,16-17H2,(H,29,30) |
| InChIKey | QCZDGGRGTNMTKO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|