C22H32F3N3O4 — CID 70374449
N-(piperidin-2-ylmethyl)-2-(2-piperidin-1-yloxyethoxy)-5-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 70374449) has the molecular formula C22H32F3N3O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is N-(piperidin-2-ylmethyl)-2-(2-piperidin-1-yloxyethoxy)-5-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(piperidin-2-ylmethyl)-2-(2-piperidin-1-yloxyethoxy)-5-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 70374449 |
| Molecular Formula | C22H32F3N3O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-(piperidin-2-ylmethyl)-2-(2-piperidin-1-yloxyethoxy)-5-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NCC1CCCCN1)c1cc(OCC(F)(F)F)ccc1OCCON1CCCCC1 |
| InChI | InChI=1S/C22H32F3N3O4/c23-22(24,25)16-31-18-7-8-20(30-12-13-32-28-10-4-1-5-11-28)19(14-18)21(29)27-15-17-6-2-3-9-26-17/h7-8,14,17,26H,1-6,9-13,15-16H2,(H,27,29) |
| InChIKey | HTVUBZMVCFQCIL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|