C20H28ClF3N2O5 — CID 23035281
5-[3-(piperidin-2-ylmethylcarbamoyl)-4-(2,2,2-trifluoroethoxy)phenoxy]pentanoic acid;hydrochloride (PubChem CID 23035281) has the molecular formula C20H28ClF3N2O5 and a molecular weight of 468.90 g/mol. Its IUPAC name is 5-[3-(piperidin-2-ylmethylcarbamoyl)-4-(2,2,2-trifluoroethoxy)phenoxy]pentanoic acid;hydrochloride.
| Compound Name | 5-[3-(piperidin-2-ylmethylcarbamoyl)-4-(2,2,2-trifluoroethoxy)phenoxy]pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 23035281 |
| Molecular Formula | C20H28ClF3N2O5 |
| Molecular Weight | 468.90 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 5-[3-(piperidin-2-ylmethylcarbamoyl)-4-(2,2,2-trifluoroethoxy)phenoxy]pentanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCCCOc1ccc(OCC(F)(F)F)c(C(=O)NCC2CCCCN2)c1 |
| InChI | InChI=1S/C20H27F3N2O5.ClH/c21-20(22,23)13-30-17-8-7-15(29-10-4-2-6-18(26)27)11-16(17)19(28)25-12-14-5-1-3-9-24-14;/h7-8,11,14,24H,1-6,9-10,12-13H2,(H,25,28)(H,26,27);1H |
| InChIKey | LVKHRLVJYZXCMI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|