C17H21F6N2O3+ — CID 3355
[2,5-bis(2,2,2-trifluoroethoxy)benzoyl]-(piperidin-2-ylmethyl)azanium (PubChem CID 3355) has the molecular formula C17H21F6N2O3+ and a molecular weight of 415.35 g/mol. Its IUPAC name is [2,5-bis(2,2,2-trifluoroethoxy)benzoyl]-(piperidin-2-ylmethyl)azanium.
| Compound Name | [2,5-bis(2,2,2-trifluoroethoxy)benzoyl]-(piperidin-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 3355 |
| Molecular Formula | C17H21F6N2O3+ |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [2,5-bis(2,2,2-trifluoroethoxy)benzoyl]-(piperidin-2-ylmethyl)azanium |
| SMILES | O=C([NH2+]CC1CCCCN1)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C17H20F6N2O3/c18-16(19,20)9-27-12-4-5-14(28-10-17(21,22)23)13(7-12)15(26)25-8-11-3-1-2-6-24-11/h4-5,7,11,24H,1-3,6,8-10H2,(H,25,26)/p+1 |
| InChIKey | DJBNUMBKLMJRSA-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |