C18H25F3N2O4 — CID 15055932
5-(2-methoxyethoxy)-N-(piperidin-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 15055932) has the molecular formula C18H25F3N2O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 5-(2-methoxyethoxy)-N-(piperidin-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 5-(2-methoxyethoxy)-N-(piperidin-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 15055932 |
| Molecular Formula | C18H25F3N2O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 5-(2-methoxyethoxy)-N-(piperidin-2-ylmethyl)-2-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | COCCOc1ccc(OCC(F)(F)F)c(C(=O)NCC2CCCCN2)c1 |
| InChI | InChI=1S/C18H25F3N2O4/c1-25-8-9-26-14-5-6-16(27-12-18(19,20)21)15(10-14)17(24)23-11-13-4-2-3-7-22-13/h5-6,10,13,22H,2-4,7-9,11-12H2,1H3,(H,23,24) |
| InChIKey | DZZHUZHKQNRERT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|